C14H19FN2O3 — CID 119804499
N-[2-(4-fluorophenoxy)propyl]morpholine-2-carboxamide (PubChem CID 119804499) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)propyl]morpholine-2-carboxamide.
| Compound Name | N-[2-(4-fluorophenoxy)propyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119804499 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-[2-(4-fluorophenoxy)propyl]morpholine-2-carboxamide |
| SMILES | CC(CNC(=O)C1CNCCO1)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O3/c1-10(20-12-4-2-11(15)3-5-12)8-17-14(18)13-9-16-6-7-19-13/h2-5,10,13,16H,6-9H2,1H3,(H,17,18) |
| InChIKey | ICAZZXAVQIHKDT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |