C10H19ClN2O4 — CID 119768677
methyl 2-methyl-3-(morpholine-2-carbonylamino)propanoate;hydrochloride (PubChem CID 119768677) has the molecular formula C10H19ClN2O4 and a molecular weight of 266.72 g/mol. Its IUPAC name is methyl 2-methyl-3-(morpholine-2-carbonylamino)propanoate;hydrochloride.
| Compound Name | methyl 2-methyl-3-(morpholine-2-carbonylamino)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119768677 |
| Molecular Formula | C10H19ClN2O4 |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | methyl 2-methyl-3-(morpholine-2-carbonylamino)propanoate;hydrochloride |
| SMILES | COC(=O)C(C)CNC(=O)C1CNCCO1.Cl |
| InChI | InChI=1S/C10H18N2O4.ClH/c1-7(10(14)15-2)5-12-9(13)8-6-11-3-4-16-8;/h7-8,11H,3-6H2,1-2H3,(H,12,13);1H |
| InChIKey | JYOWFXSYLUJBOJ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |