C14H29Cl2N3O2 — CID 119866591
N-[2-(4-methylpiperidin-1-yl)propyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 119866591) has the molecular formula C14H29Cl2N3O2 and a molecular weight of 342.31 g/mol. Its IUPAC name is N-[2-(4-methylpiperidin-1-yl)propyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(4-methylpiperidin-1-yl)propyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119866591 |
| Molecular Formula | C14H29Cl2N3O2 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-[2-(4-methylpiperidin-1-yl)propyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | CC1CCN(C(C)CNC(=O)C2CNCCO2)CC1.Cl.Cl |
| InChI | InChI=1S/C14H27N3O2.2ClH/c1-11-3-6-17(7-4-11)12(2)9-16-14(18)13-10-15-5-8-19-13;;/h11-13,15H,3-10H2,1-2H3,(H,16,18);2*1H |
| InChIKey | BDSZWZPTNVPPHT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |