C16H23ClN2O — CID 119698902
(3-aminocyclopentyl)-(2-phenylpyrrolidin-1-yl)methanone;hydrochloride (PubChem CID 119698902) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is (3-aminocyclopentyl)-(2-phenylpyrrolidin-1-yl)methanone;hydrochloride.
| Compound Name | (3-aminocyclopentyl)-(2-phenylpyrrolidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119698902 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (3-aminocyclopentyl)-(2-phenylpyrrolidin-1-yl)methanone;hydrochloride |
| SMILES | Cl.NC1CCC(C(=O)N2CCCC2c2ccccc2)C1 |
| InChI | InChI=1S/C16H22N2O.ClH/c17-14-9-8-13(11-14)16(19)18-10-4-7-15(18)12-5-2-1-3-6-12;/h1-3,5-6,13-15H,4,7-11,17H2;1H |
| InChIKey | WIKUNMGKHVRZLL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |