C17H24BrClN2O — CID 119727217
(3-aminocyclohexyl)-[2-(3-bromophenyl)pyrrolidin-1-yl]methanone;hydrochloride (PubChem CID 119727217) has the molecular formula C17H24BrClN2O and a molecular weight of 387.75 g/mol. Its IUPAC name is (3-aminocyclohexyl)-[2-(3-bromophenyl)pyrrolidin-1-yl]methanone;hydrochloride.
| Compound Name | (3-aminocyclohexyl)-[2-(3-bromophenyl)pyrrolidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119727217 |
| Molecular Formula | C17H24BrClN2O |
| Molecular Weight | 387.75 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | (3-aminocyclohexyl)-[2-(3-bromophenyl)pyrrolidin-1-yl]methanone;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)N2CCCC2c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C17H23BrN2O.ClH/c18-14-6-1-4-12(10-14)16-8-3-9-20(16)17(21)13-5-2-7-15(19)11-13;/h1,4,6,10,13,15-16H,2-3,5,7-9,11,19H2;1H |
| InChIKey | JDEXVMGBGQNQAD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |