C13H19BrN2O2S — CID 119699598
N-[2-(5-bromothiophen-2-yl)ethyl]-4-methoxypiperidine-4-carboxamide (PubChem CID 119699598) has the molecular formula C13H19BrN2O2S and a molecular weight of 347.28 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-4-methoxypiperidine-4-carboxamide.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-4-methoxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119699598 |
| Molecular Formula | C13H19BrN2O2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-4-methoxypiperidine-4-carboxamide |
| SMILES | COC1(C(=O)NCCc2ccc(Br)s2)CCNCC1 |
| InChI | InChI=1S/C13H19BrN2O2S/c1-18-13(5-8-15-9-6-13)12(17)16-7-4-10-2-3-11(14)19-10/h2-3,15H,4-9H2,1H3,(H,16,17) |
| InChIKey | UCQFTHPPGDTVAS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |