C21H28N2O4 — CID 119699969
(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-morpholin-2-ylmethanone (PubChem CID 119699969) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is (6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-morpholin-2-ylmethanone.
| Compound Name | (6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 119699969 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-morpholin-2-ylmethanone |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1C(=O)C1CNCCO1)OCCO3 |
| InChI | InChI=1S/C21H28N2O4/c1-14-15-10-17-18(27-9-8-26-17)11-16(15)21(4-2-3-5-21)13-23(14)20(24)19-12-22-6-7-25-19/h10-11,14,19,22H,2-9,12-13H2,1H3 |
| InChIKey | SYKSACCGBTVKMB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |