C16H23ClN2O3 — CID 119700017
[2-(3-methoxyphenyl)pyrrolidin-1-yl]-morpholin-2-ylmethanone;hydrochloride (PubChem CID 119700017) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)pyrrolidin-1-yl]-morpholin-2-ylmethanone;hydrochloride.
| Compound Name | [2-(3-methoxyphenyl)pyrrolidin-1-yl]-morpholin-2-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119700017 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [2-(3-methoxyphenyl)pyrrolidin-1-yl]-morpholin-2-ylmethanone;hydrochloride |
| SMILES | COc1cccc(C2CCCN2C(=O)C2CNCCO2)c1.Cl |
| InChI | InChI=1S/C16H22N2O3.ClH/c1-20-13-5-2-4-12(10-13)14-6-3-8-18(14)16(19)15-11-17-7-9-21-15;/h2,4-5,10,14-15,17H,3,6-9,11H2,1H3;1H |
| InChIKey | ZEOGHOTZTHCOMF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |