C10H21ClN4O3S — CID 119701502
4-(2-pyrrolidin-2-ylacetyl)piperazine-1-sulfonamide;hydrochloride (PubChem CID 119701502) has the molecular formula C10H21ClN4O3S and a molecular weight of 312.82 g/mol. Its IUPAC name is 4-(2-pyrrolidin-2-ylacetyl)piperazine-1-sulfonamide;hydrochloride.
| Compound Name | 4-(2-pyrrolidin-2-ylacetyl)piperazine-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119701502 |
| Molecular Formula | C10H21ClN4O3S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-(2-pyrrolidin-2-ylacetyl)piperazine-1-sulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)N1CCN(C(=O)CC2CCCN2)CC1 |
| InChI | InChI=1S/C10H20N4O3S.ClH/c11-18(16,17)14-6-4-13(5-7-14)10(15)8-9-2-1-3-12-9;/h9,12H,1-8H2,(H2,11,16,17);1H |
| InChIKey | GSTKWQPAJYHXRX-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |