C13H23ClN2O — CID 119783256
1-(4-ethenylpiperidin-1-yl)-2-pyrrolidin-2-ylethanone;hydrochloride (PubChem CID 119783256) has the molecular formula C13H23ClN2O and a molecular weight of 258.79 g/mol. Its IUPAC name is 1-(4-ethenylpiperidin-1-yl)-2-pyrrolidin-2-ylethanone;hydrochloride.
| Compound Name | 1-(4-ethenylpiperidin-1-yl)-2-pyrrolidin-2-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119783256 |
| Molecular Formula | C13H23ClN2O |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 1-(4-ethenylpiperidin-1-yl)-2-pyrrolidin-2-ylethanone;hydrochloride |
| SMILES | C=CC1CCN(C(=O)CC2CCCN2)CC1.Cl |
| InChI | InChI=1S/C13H22N2O.ClH/c1-2-11-5-8-15(9-6-11)13(16)10-12-4-3-7-14-12;/h2,11-12,14H,1,3-10H2;1H |
| InChIKey | LBIXHWYXQGYCCF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|