C20H21F3N4O — CID 119701514
4-(methylamino)-N-[phenyl-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]butanamide (PubChem CID 119701514) has the molecular formula C20H21F3N4O and a molecular weight of 390.41 g/mol. Its IUPAC name is 4-(methylamino)-N-[phenyl-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]butanamide.
| Compound Name | 4-(methylamino)-N-[phenyl-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]butanamide |
|---|---|
| PubChem CID | 119701514 |
| Molecular Formula | C20H21F3N4O |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-(methylamino)-N-[phenyl-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]butanamide |
| SMILES | CNCCCC(=O)NC(c1ccccc1)c1ccc2nc(C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C20H21F3N4O/c1-24-11-5-8-17(28)27-18(13-6-3-2-4-7-13)14-9-10-15-16(12-14)26-19(25-15)20(21,22)23/h2-4,6-7,9-10,12,18,24H,5,8,11H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | CGTSONGSSAVFJN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|