C20H14F3N3O2 — CID 25358436
N-[(S)-phenyl-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]furan-2-carboxamide (PubChem CID 25358436) has the molecular formula C20H14F3N3O2 and a molecular weight of 385.35 g/mol. Its IUPAC name is N-[(S)-phenyl-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[(S)-phenyl-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25358436 |
| Molecular Formula | C20H14F3N3O2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[(S)-phenyl-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]furan-2-carboxamide |
| SMILES | O=C(N[C@@H](c1ccccc1)c1ccc2nc(C(F)(F)F)[nH]c2c1)c1ccco1 |
| InChI | InChI=1S/C20H14F3N3O2/c21-20(22,23)19-24-14-9-8-13(11-15(14)25-19)17(12-5-2-1-3-6-12)26-18(27)16-7-4-10-28-16/h1-11,17H,(H,24,25)(H,26,27)/t17-/m0/s1 |
| InChIKey | ASPIUVPWBJPFDY-KRWDZBQOSA-N |
| XLogP | 4.69 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |