C13H20ClN3O3S — CID 119701886
2-(cyclopropylmethylamino)-N-[4-(sulfamoylmethyl)phenyl]acetamide;hydrochloride (PubChem CID 119701886) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-[4-(sulfamoylmethyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-(cyclopropylmethylamino)-N-[4-(sulfamoylmethyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119701886 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-[4-(sulfamoylmethyl)phenyl]acetamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)Cc1ccc(NC(=O)CNCC2CC2)cc1 |
| InChI | InChI=1S/C13H19N3O3S.ClH/c14-20(18,19)9-11-3-5-12(6-4-11)16-13(17)8-15-7-10-1-2-10;/h3-6,10,15H,1-2,7-9H2,(H,16,17)(H2,14,18,19);1H |
| InChIKey | DPZUCBVWQIDRFR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |