C14H19ClN4O3S — CID 119702153
methyl 4-[2-[4-(methylamino)butanoylamino]-1,3-thiazol-4-yl]-1H-pyrrole-2-carboxylate;hydrochloride (PubChem CID 119702153) has the molecular formula C14H19ClN4O3S and a molecular weight of 358.85 g/mol. Its IUPAC name is methyl 4-[2-[4-(methylamino)butanoylamino]-1,3-thiazol-4-yl]-1H-pyrrole-2-carboxylate;hydrochloride.
| Compound Name | methyl 4-[2-[4-(methylamino)butanoylamino]-1,3-thiazol-4-yl]-1H-pyrrole-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119702153 |
| Molecular Formula | C14H19ClN4O3S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | methyl 4-[2-[4-(methylamino)butanoylamino]-1,3-thiazol-4-yl]-1H-pyrrole-2-carboxylate;hydrochloride |
| SMILES | CNCCCC(=O)Nc1nc(-c2c[nH]c(C(=O)OC)c2)cs1.Cl |
| InChI | InChI=1S/C14H18N4O3S.ClH/c1-15-5-3-4-12(19)18-14-17-11(8-22-14)9-6-10(16-7-9)13(20)21-2;/h6-8,15-16H,3-5H2,1-2H3,(H,17,18,19);1H |
| InChIKey | JANHTMRNDALVST-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|