C17H14IN3O4S — CID 55548975
methyl 4-[2-[[2-(4-iodophenoxy)acetyl]amino]-1,3-thiazol-4-yl]-1H-pyrrole-2-carboxylate (PubChem CID 55548975) has the molecular formula C17H14IN3O4S and a molecular weight of 483.29 g/mol. Its IUPAC name is methyl 4-[2-[[2-(4-iodophenoxy)acetyl]amino]-1,3-thiazol-4-yl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[[2-(4-iodophenoxy)acetyl]amino]-1,3-thiazol-4-yl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 55548975 |
| Molecular Formula | C17H14IN3O4S |
| Molecular Weight | 483.29 g/mol |
| Exact Mass | 482.97 |
| IUPAC Name | methyl 4-[2-[[2-(4-iodophenoxy)acetyl]amino]-1,3-thiazol-4-yl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2csc(NC(=O)COc3ccc(I)cc3)n2)c[nH]1 |
| InChI | InChI=1S/C17H14IN3O4S/c1-24-16(23)13-6-10(7-19-13)14-9-26-17(20-14)21-15(22)8-25-12-4-2-11(18)3-5-12/h2-7,9,19H,8H2,1H3,(H,20,21,22) |
| InChIKey | GOKRGVMLIAPPSG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|