C20H24N2O — CID 119707661
3-amino-N-methyl-N-(naphthalen-1-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 119707661) has the molecular formula C20H24N2O and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-amino-N-methyl-N-(naphthalen-1-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-amino-N-methyl-N-(naphthalen-1-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 119707661 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 3-amino-N-methyl-N-(naphthalen-1-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CN(Cc1cccc2ccccc12)C(=O)C1C2CCC(C2)C1N |
| InChI | InChI=1S/C20H24N2O/c1-22(20(23)18-14-9-10-15(11-14)19(18)21)12-16-7-4-6-13-5-2-3-8-17(13)16/h2-8,14-15,18-19H,9-12,21H2,1H3 |
| InChIKey | AVCJECPUZBAVDI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |