C22H28N2O — CID 120985296
9-amino-N-methyl-N-(naphthalen-1-ylmethyl)bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 120985296) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 9-amino-N-methyl-N-(naphthalen-1-ylmethyl)bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 9-amino-N-methyl-N-(naphthalen-1-ylmethyl)bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 120985296 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 9-amino-N-methyl-N-(naphthalen-1-ylmethyl)bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CN(Cc1cccc2ccccc12)C(=O)C1CC2CCCC(C1)C2N |
| InChI | InChI=1S/C22H28N2O/c1-24(14-18-10-4-7-15-6-2-3-11-20(15)18)22(25)19-12-16-8-5-9-17(13-19)21(16)23/h2-4,6-7,10-11,16-17,19,21H,5,8-9,12-14,23H2,1H3 |
| InChIKey | KXSRGXNKLAGSFJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |