C12H20ClN3O3S — CID 119710882
3-amino-N-[[4-(methanesulfonamido)phenyl]methyl]butanamide;hydrochloride (PubChem CID 119710882) has the molecular formula C12H20ClN3O3S and a molecular weight of 321.83 g/mol. Its IUPAC name is 3-amino-N-[[4-(methanesulfonamido)phenyl]methyl]butanamide;hydrochloride.
| Compound Name | 3-amino-N-[[4-(methanesulfonamido)phenyl]methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119710882 |
| Molecular Formula | C12H20ClN3O3S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 3-amino-N-[[4-(methanesulfonamido)phenyl]methyl]butanamide;hydrochloride |
| SMILES | CC(N)CC(=O)NCc1ccc(NS(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C12H19N3O3S.ClH/c1-9(13)7-12(16)14-8-10-3-5-11(6-4-10)15-19(2,17)18;/h3-6,9,15H,7-8,13H2,1-2H3,(H,14,16);1H |
| InChIKey | JGNQYXUBKLNLGY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |