C20H30ClN3O2 — CID 119712533
2-chloro-N,N-diethyl-4-(3-piperidin-3-ylbutanoylamino)benzamide (PubChem CID 119712533) has the molecular formula C20H30ClN3O2 and a molecular weight of 379.93 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-(3-piperidin-3-ylbutanoylamino)benzamide.
| Compound Name | 2-chloro-N,N-diethyl-4-(3-piperidin-3-ylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 119712533 |
| Molecular Formula | C20H30ClN3O2 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-(3-piperidin-3-ylbutanoylamino)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CC(C)C2CCCNC2)cc1Cl |
| InChI | InChI=1S/C20H30ClN3O2/c1-4-24(5-2)20(26)17-9-8-16(12-18(17)21)23-19(25)11-14(3)15-7-6-10-22-13-15/h8-9,12,14-15,22H,4-7,10-11,13H2,1-3H3,(H,23,25) |
| InChIKey | PEAYCGWUZDNSTI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |