C17H28ClN3O2 — CID 119712810
N,N-diethyl-4-[[4-(methylamino)butanoylamino]methyl]benzamide;hydrochloride (PubChem CID 119712810) has the molecular formula C17H28ClN3O2 and a molecular weight of 341.88 g/mol. Its IUPAC name is N,N-diethyl-4-[[4-(methylamino)butanoylamino]methyl]benzamide;hydrochloride.
| Compound Name | N,N-diethyl-4-[[4-(methylamino)butanoylamino]methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119712810 |
| Molecular Formula | C17H28ClN3O2 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N,N-diethyl-4-[[4-(methylamino)butanoylamino]methyl]benzamide;hydrochloride |
| SMILES | CCN(CC)C(=O)c1ccc(CNC(=O)CCCNC)cc1.Cl |
| InChI | InChI=1S/C17H27N3O2.ClH/c1-4-20(5-2)17(22)15-10-8-14(9-11-15)13-19-16(21)7-6-12-18-3;/h8-11,18H,4-7,12-13H2,1-3H3,(H,19,21);1H |
| InChIKey | QTAJNOZQQBYTFI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|