C18H28ClN3O2 — CID 119714058
N,4-dimethyl-3-(3-piperidin-3-ylbutanoylamino)benzamide;hydrochloride (PubChem CID 119714058) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is N,4-dimethyl-3-(3-piperidin-3-ylbutanoylamino)benzamide;hydrochloride.
| Compound Name | N,4-dimethyl-3-(3-piperidin-3-ylbutanoylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119714058 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N,4-dimethyl-3-(3-piperidin-3-ylbutanoylamino)benzamide;hydrochloride |
| SMILES | CNC(=O)c1ccc(C)c(NC(=O)CC(C)C2CCCNC2)c1.Cl |
| InChI | InChI=1S/C18H27N3O2.ClH/c1-12-6-7-14(18(23)19-3)10-16(12)21-17(22)9-13(2)15-5-4-8-20-11-15;/h6-7,10,13,15,20H,4-5,8-9,11H2,1-3H3,(H,19,23)(H,21,22);1H |
| InChIKey | AUZUCYDNGOQZSR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |