C23H30ClN3O3 — CID 119718484
3-amino-N-[[4-(4-phenoxybutanoylamino)phenyl]methyl]cyclopentane-1-carboxamide;hydrochloride (PubChem CID 119718484) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is 3-amino-N-[[4-(4-phenoxybutanoylamino)phenyl]methyl]cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[[4-(4-phenoxybutanoylamino)phenyl]methyl]cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119718484 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 3-amino-N-[[4-(4-phenoxybutanoylamino)phenyl]methyl]cyclopentane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCC(C(=O)NCc2ccc(NC(=O)CCCOc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C23H29N3O3.ClH/c24-19-11-10-18(15-19)23(28)25-16-17-8-12-20(13-9-17)26-22(27)7-4-14-29-21-5-2-1-3-6-21;/h1-3,5-6,8-9,12-13,18-19H,4,7,10-11,14-16,24H2,(H,25,28)(H,26,27);1H |
| InChIKey | UJWMDZCYAPLSAF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|