C21H25ClN2O3 — CID 119773406
3-amino-N-[[4-[2-(4-chlorophenoxy)ethoxy]phenyl]methyl]cyclopentane-1-carboxamide (PubChem CID 119773406) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is 3-amino-N-[[4-[2-(4-chlorophenoxy)ethoxy]phenyl]methyl]cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-[[4-[2-(4-chlorophenoxy)ethoxy]phenyl]methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119773406 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-amino-N-[[4-[2-(4-chlorophenoxy)ethoxy]phenyl]methyl]cyclopentane-1-carboxamide |
| SMILES | NC1CCC(C(=O)NCc2ccc(OCCOc3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C21H25ClN2O3/c22-17-4-9-20(10-5-17)27-12-11-26-19-7-1-15(2-8-19)14-24-21(25)16-3-6-18(23)13-16/h1-2,4-5,7-10,16,18H,3,6,11-14,23H2,(H,24,25) |
| InChIKey | RVWFTBABQYFQHW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|