C17H27ClN2O4 — CID 155938702
(1S,3R,4R)-3-amino-4-hydroxy-N-[[4-(2-methoxyethoxy)phenyl]methyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 155938702) has the molecular formula C17H27ClN2O4 and a molecular weight of 358.87 g/mol. Its IUPAC name is (1S,3R,4R)-3-amino-4-hydroxy-N-[[4-(2-methoxyethoxy)phenyl]methyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | (1S,3R,4R)-3-amino-4-hydroxy-N-[[4-(2-methoxyethoxy)phenyl]methyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 155938702 |
| Molecular Formula | C17H27ClN2O4 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (1S,3R,4R)-3-amino-4-hydroxy-N-[[4-(2-methoxyethoxy)phenyl]methyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | COCCOc1ccc(CNC(=O)[C@H]2CC[C@@H](O)[C@H](N)C2)cc1.Cl |
| InChI | InChI=1S/C17H26N2O4.ClH/c1-22-8-9-23-14-5-2-12(3-6-14)11-19-17(21)13-4-7-16(20)15(18)10-13;/h2-3,5-6,13,15-16,20H,4,7-11,18H2,1H3,(H,19,21);1H/t13-,15+,16+;/m0./s1 |
| InChIKey | IHYIHAGWJRYHIR-QALYCTJVSA-N |
| XLogP | 1.24 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|