C17H22FN3OS — CID 119719234
7-amino-N-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]heptanamide (PubChem CID 119719234) has the molecular formula C17H22FN3OS and a molecular weight of 335.45 g/mol. Its IUPAC name is 7-amino-N-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]heptanamide.
| Compound Name | 7-amino-N-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]heptanamide |
|---|---|
| PubChem CID | 119719234 |
| Molecular Formula | C17H22FN3OS |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 7-amino-N-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]heptanamide |
| SMILES | NCCCCCCC(=O)Nc1ncc(Cc2cccc(F)c2)s1 |
| InChI | InChI=1S/C17H22FN3OS/c18-14-7-5-6-13(10-14)11-15-12-20-17(23-15)21-16(22)8-3-1-2-4-9-19/h5-7,10,12H,1-4,8-9,11,19H2,(H,20,21,22) |
| InChIKey | RSIBVVGPIRGCJC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|