C21H18ClF2N3O2S — CID 42353957
N-[4-[[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 42353957) has the molecular formula C21H18ClF2N3O2S and a molecular weight of 449.91 g/mol. Its IUPAC name is N-[4-[[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 42353957 |
| Molecular Formula | C21H18ClF2N3O2S |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | N-[4-[[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)Nc1ncc(Cc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C21H18ClF2N3O2S/c22-14-4-1-3-13(9-14)10-16-12-26-21(30-16)27-19(28)5-2-8-25-20(29)17-7-6-15(23)11-18(17)24/h1,3-4,6-7,9,11-12H,2,5,8,10H2,(H,25,29)(H,26,27,28) |
| InChIKey | CXXWGOZCZFJVJU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|