C14H22ClFN2O2 — CID 119719440
2-amino-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-methylpentanamide;hydrochloride (PubChem CID 119719440) has the molecular formula C14H22ClFN2O2 and a molecular weight of 304.79 g/mol. Its IUPAC name is 2-amino-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119719440 |
| Molecular Formula | C14H22ClFN2O2 |
| Molecular Weight | 304.79 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-amino-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-methylpentanamide;hydrochloride |
| SMILES | CCC(C)C(N)C(=O)NCC(O)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C14H21FN2O2.ClH/c1-3-9(2)13(16)14(19)17-8-12(18)10-4-6-11(15)7-5-10;/h4-7,9,12-13,18H,3,8,16H2,1-2H3,(H,17,19);1H |
| InChIKey | BWTRJSJCVGISEM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.79 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |