C15H22ClN3O2 — CID 119719955
3-[[(3-aminocyclopentanecarbonyl)amino]methyl]-N-methylbenzamide;hydrochloride (PubChem CID 119719955) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 3-[[(3-aminocyclopentanecarbonyl)amino]methyl]-N-methylbenzamide;hydrochloride.
| Compound Name | 3-[[(3-aminocyclopentanecarbonyl)amino]methyl]-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119719955 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-[[(3-aminocyclopentanecarbonyl)amino]methyl]-N-methylbenzamide;hydrochloride |
| SMILES | CNC(=O)c1cccc(CNC(=O)C2CCC(N)C2)c1.Cl |
| InChI | InChI=1S/C15H21N3O2.ClH/c1-17-14(19)11-4-2-3-10(7-11)9-18-15(20)12-5-6-13(16)8-12;/h2-4,7,12-13H,5-6,8-9,16H2,1H3,(H,17,19)(H,18,20);1H |
| InChIKey | UGYJVNLTLLNMMP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |