C14H16N2O4 — CID 120549379
2-[[3-(methylcarbamoyl)phenyl]methylcarbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 120549379) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-[[3-(methylcarbamoyl)phenyl]methylcarbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[[3-(methylcarbamoyl)phenyl]methylcarbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 120549379 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[[3-(methylcarbamoyl)phenyl]methylcarbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | CNC(=O)c1cccc(CNC(=O)C2CC2C(=O)O)c1 |
| InChI | InChI=1S/C14H16N2O4/c1-15-12(17)9-4-2-3-8(5-9)7-16-13(18)10-6-11(10)14(19)20/h2-5,10-11H,6-7H2,1H3,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | QCIQGOMBYVNFRY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |