C15H16N4O3 — CID 119720300
N-(3-pyrazin-2-yloxyphenyl)morpholine-3-carboxamide (PubChem CID 119720300) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is N-(3-pyrazin-2-yloxyphenyl)morpholine-3-carboxamide.
| Compound Name | N-(3-pyrazin-2-yloxyphenyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119720300 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-(3-pyrazin-2-yloxyphenyl)morpholine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2cnccn2)c1)C1COCCN1 |
| InChI | InChI=1S/C15H16N4O3/c20-15(13-10-21-7-6-17-13)19-11-2-1-3-12(8-11)22-14-9-16-4-5-18-14/h1-5,8-9,13,17H,6-7,10H2,(H,19,20) |
| InChIKey | DQCYNLXSJCIXGU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |