C18H19N3O2 — CID 98752390
(1S,2S,4S)-N-(3-pyrazin-2-yloxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 98752390) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is (1S,2S,4S)-N-(3-pyrazin-2-yloxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,4S)-N-(3-pyrazin-2-yloxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 98752390 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (1S,2S,4S)-N-(3-pyrazin-2-yloxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2cnccn2)c1)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C18H19N3O2/c22-18(16-9-12-4-5-13(16)8-12)21-14-2-1-3-15(10-14)23-17-11-19-6-7-20-17/h1-3,6-7,10-13,16H,4-5,8-9H2,(H,21,22)/t12-,13-,16-/m0/s1 |
| InChIKey | BNWVPYPVPUECRC-XEZPLFJOSA-N |
| XLogP | 3.64 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |