C15H21ClN6O2 — CID 119720377
4-methoxy-N-[4-methyl-3-(tetrazol-1-yl)phenyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 119720377) has the molecular formula C15H21ClN6O2 and a molecular weight of 352.83 g/mol. Its IUPAC name is 4-methoxy-N-[4-methyl-3-(tetrazol-1-yl)phenyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-methoxy-N-[4-methyl-3-(tetrazol-1-yl)phenyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119720377 |
| Molecular Formula | C15H21ClN6O2 |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 4-methoxy-N-[4-methyl-3-(tetrazol-1-yl)phenyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)Nc2ccc(C)c(-n3cnnn3)c2)CCNCC1.Cl |
| InChI | InChI=1S/C15H20N6O2.ClH/c1-11-3-4-12(9-13(11)21-10-17-19-20-21)18-14(22)15(23-2)5-7-16-8-6-15;/h3-4,9-10,16H,5-8H2,1-2H3,(H,18,22);1H |
| InChIKey | JFVRPOXELIITHD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |