C16H31N3O3S — CID 119722485
N-[[1-(3-piperidin-3-ylbutanoyl)piperidin-3-yl]methyl]methanesulfonamide (PubChem CID 119722485) has the molecular formula C16H31N3O3S and a molecular weight of 345.51 g/mol. Its IUPAC name is N-[[1-(3-piperidin-3-ylbutanoyl)piperidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-(3-piperidin-3-ylbutanoyl)piperidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 119722485 |
| Molecular Formula | C16H31N3O3S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[[1-(3-piperidin-3-ylbutanoyl)piperidin-3-yl]methyl]methanesulfonamide |
| SMILES | CC(CC(=O)N1CCCC(CNS(C)(=O)=O)C1)C1CCCNC1 |
| InChI | InChI=1S/C16H31N3O3S/c1-13(15-6-3-7-17-11-15)9-16(20)19-8-4-5-14(12-19)10-18-23(2,21)22/h13-15,17-18H,3-12H2,1-2H3 |
| InChIKey | MTSHTRZTJYOTSM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |