C17H24Cl2N2O3 — CID 119724483
1-[4-(4-chlorobenzoyl)piperidin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride (PubChem CID 119724483) has the molecular formula C17H24Cl2N2O3 and a molecular weight of 375.30 g/mol. Its IUPAC name is 1-[4-(4-chlorobenzoyl)piperidin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride.
| Compound Name | 1-[4-(4-chlorobenzoyl)piperidin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119724483 |
| Molecular Formula | C17H24Cl2N2O3 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-[4-(4-chlorobenzoyl)piperidin-1-yl]-2-(2-methoxyethylamino)ethanone;hydrochloride |
| SMILES | COCCNCC(=O)N1CCC(C(=O)c2ccc(Cl)cc2)CC1.Cl |
| InChI | InChI=1S/C17H23ClN2O3.ClH/c1-23-11-8-19-12-16(21)20-9-6-14(7-10-20)17(22)13-2-4-15(18)5-3-13;/h2-5,14,19H,6-12H2,1H3;1H |
| InChIKey | GGBAEZVXMQZFNA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|