C16H21ClN2O2S — CID 3223569
4-(4-chlorobenzoyl)-N-(2-methoxyethyl)piperidine-1-carbothioamide (PubChem CID 3223569) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is 4-(4-chlorobenzoyl)-N-(2-methoxyethyl)piperidine-1-carbothioamide.
| Compound Name | 4-(4-chlorobenzoyl)-N-(2-methoxyethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3223569 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-(4-chlorobenzoyl)-N-(2-methoxyethyl)piperidine-1-carbothioamide |
| SMILES | COCCNC(=S)N1CCC(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H21ClN2O2S/c1-21-11-8-18-16(22)19-9-6-13(7-10-19)15(20)12-2-4-14(17)5-3-12/h2-5,13H,6-11H2,1H3,(H,18,22) |
| InChIKey | UUCUXWHUSADGNX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|