C20H25FN2O — CID 119724723
2-(4-aminophenyl)-N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]acetamide (PubChem CID 119724723) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]acetamide.
| Compound Name | 2-(4-aminophenyl)-N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]acetamide |
|---|---|
| PubChem CID | 119724723 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-(4-aminophenyl)-N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]acetamide |
| SMILES | CC(C)(C)CC(NC(=O)Cc1ccc(N)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN2O/c1-20(2,3)13-18(15-6-8-16(21)9-7-15)23-19(24)12-14-4-10-17(22)11-5-14/h4-11,18H,12-13,22H2,1-3H3,(H,23,24) |
| InChIKey | DSMBEIHFMAJQMO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|