C21H33FN2O2 — CID 56521765
N',N'-diethyl-N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]pentanediamide (PubChem CID 56521765) has the molecular formula C21H33FN2O2 and a molecular weight of 364.51 g/mol. Its IUPAC name is N',N'-diethyl-N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]pentanediamide.
| Compound Name | N',N'-diethyl-N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]pentanediamide |
|---|---|
| PubChem CID | 56521765 |
| Molecular Formula | C21H33FN2O2 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N',N'-diethyl-N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]pentanediamide |
| SMILES | CCN(CC)C(=O)CCCC(=O)NC(CC(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H33FN2O2/c1-6-24(7-2)20(26)10-8-9-19(25)23-18(15-21(3,4)5)16-11-13-17(22)14-12-16/h11-14,18H,6-10,15H2,1-5H3,(H,23,25) |
| InChIKey | YAOJAJYFQFSEMD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |