C21H24FIN2O2 — CID 60518469
N-[2-[[1-(4-fluorophenyl)-3,3-dimethylbutyl]amino]-2-oxoethyl]-2-iodobenzamide (PubChem CID 60518469) has the molecular formula C21H24FIN2O2 and a molecular weight of 482.34 g/mol. Its IUPAC name is N-[2-[[1-(4-fluorophenyl)-3,3-dimethylbutyl]amino]-2-oxoethyl]-2-iodobenzamide.
| Compound Name | N-[2-[[1-(4-fluorophenyl)-3,3-dimethylbutyl]amino]-2-oxoethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 60518469 |
| Molecular Formula | C21H24FIN2O2 |
| Molecular Weight | 482.34 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | N-[2-[[1-(4-fluorophenyl)-3,3-dimethylbutyl]amino]-2-oxoethyl]-2-iodobenzamide |
| SMILES | CC(C)(C)CC(NC(=O)CNC(=O)c1ccccc1I)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FIN2O2/c1-21(2,3)12-18(14-8-10-15(22)11-9-14)25-19(26)13-24-20(27)16-6-4-5-7-17(16)23/h4-11,18H,12-13H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | JNKIIFDVGVAESZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|