C20H27N5O2 — CID 119725076
(5-methyl-1-piperidin-4-yltriazol-4-yl)-(4-phenoxypiperidin-1-yl)methanone (PubChem CID 119725076) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is (5-methyl-1-piperidin-4-yltriazol-4-yl)-(4-phenoxypiperidin-1-yl)methanone.
| Compound Name | (5-methyl-1-piperidin-4-yltriazol-4-yl)-(4-phenoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 119725076 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (5-methyl-1-piperidin-4-yltriazol-4-yl)-(4-phenoxypiperidin-1-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCC(Oc3ccccc3)CC2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C20H27N5O2/c1-15-19(22-23-25(15)16-7-11-21-12-8-16)20(26)24-13-9-18(10-14-24)27-17-5-3-2-4-6-17/h2-6,16,18,21H,7-14H2,1H3 |
| InChIKey | NVQKYXWGNQKXRT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |