C20H26N6O2 — CID 119683408
[4-(5-methyl-1-piperidin-4-yltriazole-4-carbonyl)piperazin-1-yl]-phenylmethanone (PubChem CID 119683408) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is [4-(5-methyl-1-piperidin-4-yltriazole-4-carbonyl)piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-(5-methyl-1-piperidin-4-yltriazole-4-carbonyl)piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 119683408 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [4-(5-methyl-1-piperidin-4-yltriazole-4-carbonyl)piperazin-1-yl]-phenylmethanone |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)c3ccccc3)CC2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C20H26N6O2/c1-15-18(22-23-26(15)17-7-9-21-10-8-17)20(28)25-13-11-24(12-14-25)19(27)16-5-3-2-4-6-16/h2-6,17,21H,7-14H2,1H3 |
| InChIKey | YQVOGTFHOBXZBZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |