C17H28N6O — CID 124697610
[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-1-piperidin-4-yltriazol-4-yl)methanone (PubChem CID 124697610) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-1-piperidin-4-yltriazol-4-yl)methanone.
| Compound Name | [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-1-piperidin-4-yltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 124697610 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-1-piperidin-4-yltriazol-4-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCN3CCCC[C@H]3C2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C17H28N6O/c1-13-16(19-20-23(13)14-5-7-18-8-6-14)17(24)22-11-10-21-9-3-2-4-15(21)12-22/h14-15,18H,2-12H2,1H3/t15-/m0/s1 |
| InChIKey | XFVAWCMBMUGHAR-HNNXBMFYSA-N |
| XLogP | 0.82 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |