C19H33N5O — CID 99850060
[(3S)-3-(3-methylbutyl)piperidin-1-yl]-(5-methyl-1-piperidin-4-yltriazol-4-yl)methanone (PubChem CID 99850060) has the molecular formula C19H33N5O and a molecular weight of 347.51 g/mol. Its IUPAC name is [(3S)-3-(3-methylbutyl)piperidin-1-yl]-(5-methyl-1-piperidin-4-yltriazol-4-yl)methanone.
| Compound Name | [(3S)-3-(3-methylbutyl)piperidin-1-yl]-(5-methyl-1-piperidin-4-yltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 99850060 |
| Molecular Formula | C19H33N5O |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | [(3S)-3-(3-methylbutyl)piperidin-1-yl]-(5-methyl-1-piperidin-4-yltriazol-4-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCC[C@H](CCC(C)C)C2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C19H33N5O/c1-14(2)6-7-16-5-4-12-23(13-16)19(25)18-15(3)24(22-21-18)17-8-10-20-11-9-17/h14,16-17,20H,4-13H2,1-3H3/t16-/m1/s1 |
| InChIKey | LNICXNQPPKTRGD-MRXNPFEDSA-N |
| XLogP | 2.80 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |