C17H30N4O2 — CID 119727444
N-cyclohexyl-4-(2-pyrrolidin-2-ylacetyl)piperazine-1-carboxamide (PubChem CID 119727444) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is N-cyclohexyl-4-(2-pyrrolidin-2-ylacetyl)piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(2-pyrrolidin-2-ylacetyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 119727444 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-cyclohexyl-4-(2-pyrrolidin-2-ylacetyl)piperazine-1-carboxamide |
| SMILES | O=C(CC1CCCN1)N1CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C17H30N4O2/c22-16(13-15-7-4-8-18-15)20-9-11-21(12-10-20)17(23)19-14-5-2-1-3-6-14/h14-15,18H,1-13H2,(H,19,23) |
| InChIKey | QFLDFFYFYIAAQO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |