C20H31ClN2O — CID 119728149
7-amino-N-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)heptanamide;hydrochloride (PubChem CID 119728149) has the molecular formula C20H31ClN2O and a molecular weight of 350.93 g/mol. Its IUPAC name is 7-amino-N-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)heptanamide;hydrochloride.
| Compound Name | 7-amino-N-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119728149 |
| Molecular Formula | C20H31ClN2O |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 7-amino-N-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)heptanamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)N(C1CC1)C1CCCc2ccccc21 |
| InChI | InChI=1S/C20H30N2O.ClH/c21-15-6-2-1-3-12-20(23)22(17-13-14-17)19-11-7-9-16-8-4-5-10-18(16)19;/h4-5,8,10,17,19H,1-3,6-7,9,11-15,21H2;1H |
| InChIKey | SFRJONSOVCUCQU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|