C20H23ClN2O — CID 119742610
2-(4-aminophenyl)-N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)acetamide;hydrochloride (PubChem CID 119742610) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)acetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119742610 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-(4-aminophenyl)-N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)acetamide;hydrochloride |
| SMILES | Cl.Nc1ccc(CC(=O)N(C2CC2)C2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C20H22N2O.ClH/c21-16-8-5-14(6-9-16)13-20(23)22(17-10-11-17)19-12-7-15-3-1-2-4-18(15)19;/h1-6,8-9,17,19H,7,10-13,21H2;1H |
| InChIKey | GVKBKZFNERBGRE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|