C15H25N5O2 — CID 119728755
N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]-3-piperidin-3-ylbutanamide (PubChem CID 119728755) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119728755 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]-3-piperidin-3-ylbutanamide |
| SMILES | CNC(=O)Cn1cc(NC(=O)CC(C)C2CCCNC2)cn1 |
| InChI | InChI=1S/C15H25N5O2/c1-11(12-4-3-5-17-7-12)6-14(21)19-13-8-18-20(9-13)10-15(22)16-2/h8-9,11-12,17H,3-7,10H2,1-2H3,(H,16,22)(H,19,21) |
| InChIKey | OIRVSWIRCZBIMW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |