C14H22N4O3 — CID 81049063
2-[4-(3-piperidin-3-ylbutanoylamino)pyrazol-1-yl]acetic acid (PubChem CID 81049063) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-[4-(3-piperidin-3-ylbutanoylamino)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-(3-piperidin-3-ylbutanoylamino)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 81049063 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[4-(3-piperidin-3-ylbutanoylamino)pyrazol-1-yl]acetic acid |
| SMILES | CC(CC(=O)Nc1cnn(CC(=O)O)c1)C1CCCNC1 |
| InChI | InChI=1S/C14H22N4O3/c1-10(11-3-2-4-15-6-11)5-13(19)17-12-7-16-18(8-12)9-14(20)21/h7-8,10-11,15H,2-6,9H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | QQEMDOXWWHCKSO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |