C16H26N2O3 — CID 119731994
2-amino-N-[2-(2-methoxyphenoxy)ethyl]-N,3-dimethylpentanamide (PubChem CID 119731994) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-amino-N-[2-(2-methoxyphenoxy)ethyl]-N,3-dimethylpentanamide.
| Compound Name | 2-amino-N-[2-(2-methoxyphenoxy)ethyl]-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 119731994 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-amino-N-[2-(2-methoxyphenoxy)ethyl]-N,3-dimethylpentanamide |
| SMILES | CCC(C)C(N)C(=O)N(C)CCOc1ccccc1OC |
| InChI | InChI=1S/C16H26N2O3/c1-5-12(2)15(17)16(19)18(3)10-11-21-14-9-7-6-8-13(14)20-4/h6-9,12,15H,5,10-11,17H2,1-4H3 |
| InChIKey | IKTSZXBVIACEPM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |