C14H22N2O4 — CID 120986832
2-amino-3-methoxy-N-[2-(2-methoxyphenoxy)ethyl]-N-methylpropanamide (PubChem CID 120986832) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-[2-(2-methoxyphenoxy)ethyl]-N-methylpropanamide.
| Compound Name | 2-amino-3-methoxy-N-[2-(2-methoxyphenoxy)ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 120986832 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-amino-3-methoxy-N-[2-(2-methoxyphenoxy)ethyl]-N-methylpropanamide |
| SMILES | COCC(N)C(=O)N(C)CCOc1ccccc1OC |
| InChI | InChI=1S/C14H22N2O4/c1-16(14(17)11(15)10-18-2)8-9-20-13-7-5-4-6-12(13)19-3/h4-7,11H,8-10,15H2,1-3H3 |
| InChIKey | AQZAGSFUZSXZMI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |