C72H93N8+3 — CID 11973678
5,10,15-tris(1-octylpyridin-1-ium-2-yl)-20-(1-octyl-2-pyridinylidene)-21H-porphyrin (PubChem CID 11973678) has the molecular formula C72H93N8+3 and a molecular weight of 1070.59 g/mol. Its IUPAC name is 5,10,15-tris(1-octylpyridin-1-ium-2-yl)-20-(1-octyl-2-pyridinylidene)-21H-porphyrin.
| Compound Name | 5,10,15-tris(1-octylpyridin-1-ium-2-yl)-20-(1-octyl-2-pyridinylidene)-21H-porphyrin |
|---|---|
| PubChem CID | 11973678 |
| Molecular Formula | C72H93N8+3 |
| Molecular Weight | 1070.59 g/mol |
| Exact Mass | 1069.75 |
| IUPAC Name | 5,10,15-tris(1-octylpyridin-1-ium-2-yl)-20-(1-octyl-2-pyridinylidene)-21H-porphyrin |
| SMILES | CCCCCCCCN1C=CC=CC1=C1C2=N/C(=C(/c3cccc[n+]3CCCCCCCC)C3=N/C(=C(/c4cccc[n+]4CCCCCCCC)C4=N/C(=C(/c5cccc[n+]5CCCCCCCC)c5ccc1[nH]5)C=C4)C=C3)C=C2 |
| InChI | InChI=1S/C72H93N8/c1-5-9-13-17-21-29-49-77-53-33-25-37-65(77)69-57-41-43-59(73-57)70(66-38-26-34-54-78(66)50-30-22-18-14-10-6-2)61-45-47-63(75-61)72(68-40-28-36-56-80(68)52-32-24-20-16-12-8-4)64-48-46-62(76-64)71(60-44-42-58(69)74-60)67-39-27-35-55-79(67)51-31-23-19-15-11-7-3/h25-28,33-48,53-56,73H,5-24,29-32,49-52H2,1-4H3/q+3 |
| InChIKey | LUAWOXGWBXFNHY-UHFFFAOYSA-N |
| XLogP | 17.04 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.59 |
| LogP ≤ 5 | 17.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|